C19H17BrCl2N2O — CID 18436015
4-bromo-N-[3-(chloromethyl)-8-ethylquinolin-7-yl]benzamide;hydrochloride (PubChem CID 18436015) has the molecular formula C19H17BrCl2N2O and a molecular weight of 440.17 g/mol. Its IUPAC name is 4-bromo-N-[3-(chloromethyl)-8-ethylquinolin-7-yl]benzamide;hydrochloride.
| Compound Name | 4-bromo-N-[3-(chloromethyl)-8-ethylquinolin-7-yl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 18436015 |
| Molecular Formula | C19H17BrCl2N2O |
| Molecular Weight | 440.17 g/mol |
| Exact Mass | 437.99 |
| IUPAC Name | 4-bromo-N-[3-(chloromethyl)-8-ethylquinolin-7-yl]benzamide;hydrochloride |
| SMILES | CCc1c(NC(=O)c2ccc(Br)cc2)ccc2cc(CCl)cnc12.Cl |
| InChI | InChI=1S/C19H16BrClN2O.ClH/c1-2-16-17(23-19(24)13-3-6-15(20)7-4-13)8-5-14-9-12(10-21)11-22-18(14)16;/h3-9,11H,2,10H2,1H3,(H,23,24);1H |
| InChIKey | YIJJKNQMWZRJIH-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.17 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|