About 9-trimethylsilylnona-6,8-diynal
9-trimethylsilylnona-6,8-diynal (PubChem CID 18436276) has the molecular formula C12H18OSi
and a molecular weight of 206.36 g/mol. Its IUPAC name is 9-trimethylsilylnona-6,8-diynal.
Molecular Properties
| Compound Name | 9-trimethylsilylnona-6,8-diynal |
| PubChem CID | 18436276 |
| Molecular Formula | C12H18OSi |
| Molecular Weight | 206.36 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 9-trimethylsilylnona-6,8-diynal |
| SMILES | C[Si](C)(C)C#CC#CCCCCC=O |
| InChI | InChI=1S/C12H18OSi/c1-14(2,3)12-10-8-6-4-5-7-9-11-13/h11H,4-5,7,9H2,1-3H3 |
| InChIKey | TYCRLXKXIRCQBQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-trimethylsilylnona-6,8-diynal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-trimethylsilylnona-6,8-diynal?
The IUPAC name of 9-trimethylsilylnona-6,8-diynal (CID 18436276) is 9-trimethylsilylnona-6,8-diynal.
What is the SMILES notation for 9-trimethylsilylnona-6,8-diynal?
The canonical SMILES for 9-trimethylsilylnona-6,8-diynal is C[Si](C)(C)C#CC#CCCCCC=O.
What is the InChIKey of 9-trimethylsilylnona-6,8-diynal?
The InChIKey is TYCRLXKXIRCQBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18OSi/c1-14(2,3)12-10-8-6-4-5-7-9-11-13/h11H,4-5,7,9H2,1-3H3.
What are the key properties of 9-trimethylsilylnona-6,8-diynal?
9-trimethylsilylnona-6,8-diynal has a molecular weight of 206.36 g/mol, XLogP of 2.63, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-trimethylsilylnona-6,8-diynal is sourced from PubChem (CID 18436276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).