C28H37NO3 — CID 18436347
4-[4-(hydroxymethyl)-5-methyl-6-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]cyclohex-3-en-1-yl]phenol (PubChem CID 18436347) has the molecular formula C28H37NO3 and a molecular weight of 435.61 g/mol. Its IUPAC name is 4-[4-(hydroxymethyl)-5-methyl-6-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]cyclohex-3-en-1-yl]phenol.
| Compound Name | 4-[4-(hydroxymethyl)-5-methyl-6-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]cyclohex-3-en-1-yl]phenol |
|---|---|
| PubChem CID | 18436347 |
| Molecular Formula | C28H37NO3 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.28 |
| IUPAC Name | 4-[4-(hydroxymethyl)-5-methyl-6-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]cyclohex-3-en-1-yl]phenol |
| SMILES | CC1C(CO)=CCC(c2ccc(O)cc2)C1Cc1ccc(OCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C28H37NO3/c1-21-24(20-30)9-14-27(23-7-10-25(31)11-8-23)28(21)19-22-5-12-26(13-6-22)32-18-17-29-15-3-2-4-16-29/h5-13,21,27-28,30-31H,2-4,14-20H2,1H3 |
| InChIKey | XBERZSFBWIVPQK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|