About 4-[3,4-dimethyl-4-(3-methylphenyl)piperazin-4-ium-1-yl]-2-methylaniline
4-[3,4-dimethyl-4-(3-methylphenyl)piperazin-4-ium-1-yl]-2-methylaniline (PubChem CID 18436392) has the molecular formula C20H28N3+
and a molecular weight of 310.47 g/mol. Its IUPAC name is 4-[3,4-dimethyl-4-(3-methylphenyl)piperazin-4-ium-1-yl]-2-methylaniline.
Molecular Properties
| Compound Name | 4-[3,4-dimethyl-4-(3-methylphenyl)piperazin-4-ium-1-yl]-2-methylaniline |
| PubChem CID | 18436392 |
| Molecular Formula | C20H28N3+ |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | 4-[3,4-dimethyl-4-(3-methylphenyl)piperazin-4-ium-1-yl]-2-methylaniline |
| SMILES | Cc1cccc([N+]2(C)CCN(c3ccc(N)c(C)c3)CC2C)c1 |
| InChI | InChI=1S/C20H28N3/c1-15-6-5-7-19(12-15)23(4)11-10-22(14-17(23)3)18-8-9-20(21)16(2)13-18/h5-9,12-13,17H,10-11,14,21H2,1-4H3/q+1 |
| InChIKey | ORNFZCJGJBWMQK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[3,4-dimethyl-4-(3-methylphenyl)piperazin-4-ium-1-yl]-2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,4-dimethyl-4-(3-methylphenyl)piperazin-4-ium-1-yl]-2-methylaniline?
The IUPAC name of 4-[3,4-dimethyl-4-(3-methylphenyl)piperazin-4-ium-1-yl]-2-methylaniline (CID 18436392) is 4-[3,4-dimethyl-4-(3-methylphenyl)piperazin-4-ium-1-yl]-2-methylaniline.
What is the SMILES notation for 4-[3,4-dimethyl-4-(3-methylphenyl)piperazin-4-ium-1-yl]-2-methylaniline?
The canonical SMILES for 4-[3,4-dimethyl-4-(3-methylphenyl)piperazin-4-ium-1-yl]-2-methylaniline is Cc1cccc([N+]2(C)CCN(c3ccc(N)c(C)c3)CC2C)c1.
What is the InChIKey of 4-[3,4-dimethyl-4-(3-methylphenyl)piperazin-4-ium-1-yl]-2-methylaniline?
The InChIKey is ORNFZCJGJBWMQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N3/c1-15-6-5-7-19(12-15)23(4)11-10-22(14-17(23)3)18-8-9-20(21)16(2)13-18/h5-9,12-13,17H,10-11,14,21H2,1-4H3/q+1.
What are the key properties of 4-[3,4-dimethyl-4-(3-methylphenyl)piperazin-4-ium-1-yl]-2-methylaniline?
4-[3,4-dimethyl-4-(3-methylphenyl)piperazin-4-ium-1-yl]-2-methylaniline has a molecular weight of 310.47 g/mol, XLogP of 3.73, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,4-dimethyl-4-(3-methylphenyl)piperazin-4-ium-1-yl]-2-methylaniline is sourced from PubChem (CID 18436392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).