About 6-methyl-1,4-diazepan-6-amine
6-methyl-1,4-diazepan-6-amine (PubChem CID 18436453) has the molecular formula C6H15N3
and a molecular weight of 129.21 g/mol. Its IUPAC name is 6-methyl-1,4-diazepan-6-amine.
Molecular Properties
| Compound Name | 6-methyl-1,4-diazepan-6-amine |
| PubChem CID | 18436453 |
| Molecular Formula | C6H15N3 |
| Molecular Weight | 129.21 g/mol |
| Exact Mass | 129.13 |
| IUPAC Name | 6-methyl-1,4-diazepan-6-amine |
| SMILES | CC1(N)CNCCNC1 |
| InChI | InChI=1S/C6H15N3/c1-6(7)4-8-2-3-9-5-6/h8-9H,2-5,7H2,1H3 |
| InChIKey | HRDGOMXHINSUHC-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.21 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-1,4-diazepan-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1,4-diazepan-6-amine?
The IUPAC name of 6-methyl-1,4-diazepan-6-amine (CID 18436453) is 6-methyl-1,4-diazepan-6-amine.
What is the SMILES notation for 6-methyl-1,4-diazepan-6-amine?
The canonical SMILES for 6-methyl-1,4-diazepan-6-amine is CC1(N)CNCCNC1.
What is the InChIKey of 6-methyl-1,4-diazepan-6-amine?
The InChIKey is HRDGOMXHINSUHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N3/c1-6(7)4-8-2-3-9-5-6/h8-9H,2-5,7H2,1H3.
What are the key properties of 6-methyl-1,4-diazepan-6-amine?
6-methyl-1,4-diazepan-6-amine has a molecular weight of 129.21 g/mol, XLogP of -1.10, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1,4-diazepan-6-amine is sourced from PubChem (CID 18436453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).