About 4-chloro-1-(2,6-difluorophenyl)-4-[6-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]butan-1-one
4-chloro-1-(2,6-difluorophenyl)-4-[6-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]butan-1-one (PubChem CID 18436935) has the molecular formula C22H15ClF5NO2
and a molecular weight of 455.81 g/mol. Its IUPAC name is 4-chloro-1-(2,6-difluorophenyl)-4-[6-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]butan-1-one.
Molecular Properties
| Compound Name | 4-chloro-1-(2,6-difluorophenyl)-4-[6-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]butan-1-one |
| PubChem CID | 18436935 |
| Molecular Formula | C22H15ClF5NO2 |
| Molecular Weight | 455.81 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | 4-chloro-1-(2,6-difluorophenyl)-4-[6-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]butan-1-one |
| SMILES | O=C(CCC(Cl)c1ccc(-c2ccc(OC(F)(F)F)cc2)nc1)c1c(F)cccc1F |
| InChI | InChI=1S/C22H15ClF5NO2/c23-16(9-11-20(30)21-17(24)2-1-3-18(21)25)14-6-10-19(29-12-14)13-4-7-15(8-5-13)31-22(26,27)28/h1-8,10,12,16H,9,11H2 |
| InChIKey | LAEKFRPDMPYVBX-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.81 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1-(2,6-difluorophenyl)-4-[6-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-(2,6-difluorophenyl)-4-[6-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]butan-1-one?
The IUPAC name of 4-chloro-1-(2,6-difluorophenyl)-4-[6-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]butan-1-one (CID 18436935) is 4-chloro-1-(2,6-difluorophenyl)-4-[6-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]butan-1-one.
What is the SMILES notation for 4-chloro-1-(2,6-difluorophenyl)-4-[6-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]butan-1-one?
The canonical SMILES for 4-chloro-1-(2,6-difluorophenyl)-4-[6-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]butan-1-one is O=C(CCC(Cl)c1ccc(-c2ccc(OC(F)(F)F)cc2)nc1)c1c(F)cccc1F.
What is the InChIKey of 4-chloro-1-(2,6-difluorophenyl)-4-[6-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]butan-1-one?
The InChIKey is LAEKFRPDMPYVBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15ClF5NO2/c23-16(9-11-20(30)21-17(24)2-1-3-18(21)25)14-6-10-19(29-12-14)13-4-7-15(8-5-13)31-22(26,27)28/h1-8,10,12,16H,9,11H2.
What are the key properties of 4-chloro-1-(2,6-difluorophenyl)-4-[6-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]butan-1-one?
4-chloro-1-(2,6-difluorophenyl)-4-[6-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]butan-1-one has a molecular weight of 455.81 g/mol, XLogP of 6.87, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-(2,6-difluorophenyl)-4-[6-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]butan-1-one is sourced from PubChem (CID 18436935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).