C36H36F4N4O3S — CID 18437903
4-[[(3-butyl-2,5-diphenylimidazol-4-yl)methyl-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]amino]methyl]benzenesulfonamide (PubChem CID 18437903) has the molecular formula C36H36F4N4O3S and a molecular weight of 680.77 g/mol. Its IUPAC name is 4-[[(3-butyl-2,5-diphenylimidazol-4-yl)methyl-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]amino]methyl]benzenesulfonamide.
| Compound Name | 4-[[(3-butyl-2,5-diphenylimidazol-4-yl)methyl-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 18437903 |
| Molecular Formula | C36H36F4N4O3S |
| Molecular Weight | 680.77 g/mol |
| Exact Mass | 680.24 |
| IUPAC Name | 4-[[(3-butyl-2,5-diphenylimidazol-4-yl)methyl-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]amino]methyl]benzenesulfonamide |
| SMILES | CCCCn1c(-c2ccccc2)nc(-c2ccccc2)c1CN(Cc1ccc(S(N)(=O)=O)cc1)Cc1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C36H36F4N4O3S/c1-2-3-21-44-32(33(28-12-6-4-7-13-28)42-34(44)29-14-8-5-9-15-29)25-43(23-26-17-19-31(20-18-26)48(41,45)46)24-27-11-10-16-30(22-27)47-36(39,40)35(37)38/h4-20,22,35H,2-3,21,23-25H2,1H3,(H2,41,45,46) |
| InChIKey | XOGROKBSZQSWIY-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.77 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|