C27H29N3O2 — CID 18437923
4-[[(3-butyl-2,5-diphenylimidazol-4-yl)methylamino]methyl]benzene-1,2-diol (PubChem CID 18437923) has the molecular formula C27H29N3O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 4-[[(3-butyl-2,5-diphenylimidazol-4-yl)methylamino]methyl]benzene-1,2-diol.
| Compound Name | 4-[[(3-butyl-2,5-diphenylimidazol-4-yl)methylamino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 18437923 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 4-[[(3-butyl-2,5-diphenylimidazol-4-yl)methylamino]methyl]benzene-1,2-diol |
| SMILES | CCCCn1c(-c2ccccc2)nc(-c2ccccc2)c1CNCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C27H29N3O2/c1-2-3-16-30-23(19-28-18-20-14-15-24(31)25(32)17-20)26(21-10-6-4-7-11-21)29-27(30)22-12-8-5-9-13-22/h4-15,17,28,31-32H,2-3,16,18-19H2,1H3 |
| InChIKey | ISNSJBNFTSZTHI-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|