C30H30ClN5O3 — CID 18438737
8-[(2-chlorobenzoyl)amino]-1-[4-[3-(dimethylamino)propoxy]phenyl]-4,5-dihydrobenzo[g]indazole-3-carboxamide (PubChem CID 18438737) has the molecular formula C30H30ClN5O3 and a molecular weight of 544.06 g/mol. Its IUPAC name is 8-[(2-chlorobenzoyl)amino]-1-[4-[3-(dimethylamino)propoxy]phenyl]-4,5-dihydrobenzo[g]indazole-3-carboxamide.
| Compound Name | 8-[(2-chlorobenzoyl)amino]-1-[4-[3-(dimethylamino)propoxy]phenyl]-4,5-dihydrobenzo[g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 18438737 |
| Molecular Formula | C30H30ClN5O3 |
| Molecular Weight | 544.06 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | 8-[(2-chlorobenzoyl)amino]-1-[4-[3-(dimethylamino)propoxy]phenyl]-4,5-dihydrobenzo[g]indazole-3-carboxamide |
| SMILES | CN(C)CCCOc1ccc(-n2nc(C(N)=O)c3c2-c2cc(NC(=O)c4ccccc4Cl)ccc2CC3)cc1 |
| InChI | InChI=1S/C30H30ClN5O3/c1-35(2)16-5-17-39-22-13-11-21(12-14-22)36-28-24(27(34-36)29(32)37)15-9-19-8-10-20(18-25(19)28)33-30(38)23-6-3-4-7-26(23)31/h3-4,6-8,10-14,18H,5,9,15-17H2,1-2H3,(H2,32,37)(H,33,38) |
| InChIKey | SBHNZPPAMHBCBS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.06 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|