C15H23NO4 — CID 18439129
1-[(1S,2S,3S)-2,3-dipropoxycyclopentyl]pyrrole-2,5-dione (PubChem CID 18439129) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 1-[(1S,2S,3S)-2,3-dipropoxycyclopentyl]pyrrole-2,5-dione.
| Compound Name | 1-[(1S,2S,3S)-2,3-dipropoxycyclopentyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 18439129 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 1-[(1S,2S,3S)-2,3-dipropoxycyclopentyl]pyrrole-2,5-dione |
| SMILES | CCCO[C@@H]1[C@@H](OCCC)CC[C@@H]1N1C(=O)C=CC1=O |
| InChI | InChI=1S/C15H23NO4/c1-3-9-19-12-6-5-11(15(12)20-10-4-2)16-13(17)7-8-14(16)18/h7-8,11-12,15H,3-6,9-10H2,1-2H3/t11-,12-,15-/m0/s1 |
| InChIKey | JVXKJYZVHAOSJN-HUBLWGQQSA-N |
| XLogP | 1.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|