C12H17NO5 — CID 18439139
1-(2,3,4-trimethoxycyclopentyl)pyrrole-2,5-dione (PubChem CID 18439139) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is 1-(2,3,4-trimethoxycyclopentyl)pyrrole-2,5-dione.
| Compound Name | 1-(2,3,4-trimethoxycyclopentyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 18439139 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 1-(2,3,4-trimethoxycyclopentyl)pyrrole-2,5-dione |
| SMILES | COC1CC(N2C(=O)C=CC2=O)C(OC)C1OC |
| InChI | InChI=1S/C12H17NO5/c1-16-8-6-7(11(17-2)12(8)18-3)13-9(14)4-5-10(13)15/h4-5,7-8,11-12H,6H2,1-3H3 |
| InChIKey | ZUJYLJIPXWMPEY-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|