C21H35NO5 — CID 18439141
1-[(1S,2S,3S,4S)-2,3,4-tributoxycyclopentyl]pyrrole-2,5-dione (PubChem CID 18439141) has the molecular formula C21H35NO5 and a molecular weight of 381.51 g/mol. Its IUPAC name is 1-[(1S,2S,3S,4S)-2,3,4-tributoxycyclopentyl]pyrrole-2,5-dione.
| Compound Name | 1-[(1S,2S,3S,4S)-2,3,4-tributoxycyclopentyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 18439141 |
| Molecular Formula | C21H35NO5 |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | 1-[(1S,2S,3S,4S)-2,3,4-tributoxycyclopentyl]pyrrole-2,5-dione |
| SMILES | CCCCO[C@@H]1[C@@H](OCCCC)[C@@H](N2C(=O)C=CC2=O)C[C@@H]1OCCCC |
| InChI | InChI=1S/C21H35NO5/c1-4-7-12-25-17-15-16(22-18(23)10-11-19(22)24)20(26-13-8-5-2)21(17)27-14-9-6-3/h10-11,16-17,20-21H,4-9,12-15H2,1-3H3/t16-,17-,20-,21-/m0/s1 |
| InChIKey | SAOHIEADJUBCFM-USNOLKROSA-N |
| XLogP | 3.24 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|