C18H29NO5 — CID 18439143
1-[(1S,2S,3S,4S)-2,3,4-tripropoxycyclopentyl]pyrrole-2,5-dione (PubChem CID 18439143) has the molecular formula C18H29NO5 and a molecular weight of 339.43 g/mol. Its IUPAC name is 1-[(1S,2S,3S,4S)-2,3,4-tripropoxycyclopentyl]pyrrole-2,5-dione.
| Compound Name | 1-[(1S,2S,3S,4S)-2,3,4-tripropoxycyclopentyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 18439143 |
| Molecular Formula | C18H29NO5 |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 1-[(1S,2S,3S,4S)-2,3,4-tripropoxycyclopentyl]pyrrole-2,5-dione |
| SMILES | CCCO[C@@H]1[C@@H](OCCC)[C@@H](N2C(=O)C=CC2=O)C[C@@H]1OCCC |
| InChI | InChI=1S/C18H29NO5/c1-4-9-22-14-12-13(19-15(20)7-8-16(19)21)17(23-10-5-2)18(14)24-11-6-3/h7-8,13-14,17-18H,4-6,9-12H2,1-3H3/t13-,14-,17-,18-/m0/s1 |
| InChIKey | GBHNAHWUYFSEBQ-USJZOSNVSA-N |
| XLogP | 2.07 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|