C21H35NO5 — CID 18439145
1-[2,3,4-tris[(2-methylpropan-2-yl)oxy]cyclopentyl]pyrrole-2,5-dione (PubChem CID 18439145) has the molecular formula C21H35NO5 and a molecular weight of 381.51 g/mol. Its IUPAC name is 1-[2,3,4-tris[(2-methylpropan-2-yl)oxy]cyclopentyl]pyrrole-2,5-dione.
| Compound Name | 1-[2,3,4-tris[(2-methylpropan-2-yl)oxy]cyclopentyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 18439145 |
| Molecular Formula | C21H35NO5 |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | 1-[2,3,4-tris[(2-methylpropan-2-yl)oxy]cyclopentyl]pyrrole-2,5-dione |
| SMILES | CC(C)(C)OC1CC(N2C(=O)C=CC2=O)C(OC(C)(C)C)C1OC(C)(C)C |
| InChI | InChI=1S/C21H35NO5/c1-19(2,3)25-14-12-13(22-15(23)10-11-16(22)24)17(26-20(4,5)6)18(14)27-21(7,8)9/h10-11,13-14,17-18H,12H2,1-9H3 |
| InChIKey | WGBXBULRRWRQCQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|