C17H27NO6 — CID 18439148
1-(2,3,4,5-tetraethoxycyclopentyl)pyrrole-2,5-dione (PubChem CID 18439148) has the molecular formula C17H27NO6 and a molecular weight of 341.40 g/mol. Its IUPAC name is 1-(2,3,4,5-tetraethoxycyclopentyl)pyrrole-2,5-dione.
| Compound Name | 1-(2,3,4,5-tetraethoxycyclopentyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 18439148 |
| Molecular Formula | C17H27NO6 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 1-(2,3,4,5-tetraethoxycyclopentyl)pyrrole-2,5-dione |
| SMILES | CCOC1C(OCC)C(OCC)C(N2C(=O)C=CC2=O)C1OCC |
| InChI | InChI=1S/C17H27NO6/c1-5-21-14-13(18-11(19)9-10-12(18)20)15(22-6-2)17(24-8-4)16(14)23-7-3/h9-10,13-17H,5-8H2,1-4H3 |
| InChIKey | DLYFMABLQXBMPQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|