C25H43NO6 — CID 18439155
1-[(2S,3S,4S,5S)-2,3,4,5-tetrabutoxycyclopentyl]pyrrole-2,5-dione (PubChem CID 18439155) has the molecular formula C25H43NO6 and a molecular weight of 453.62 g/mol. Its IUPAC name is 1-[(2S,3S,4S,5S)-2,3,4,5-tetrabutoxycyclopentyl]pyrrole-2,5-dione.
| Compound Name | 1-[(2S,3S,4S,5S)-2,3,4,5-tetrabutoxycyclopentyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 18439155 |
| Molecular Formula | C25H43NO6 |
| Molecular Weight | 453.62 g/mol |
| Exact Mass | 453.31 |
| IUPAC Name | 1-[(2S,3S,4S,5S)-2,3,4,5-tetrabutoxycyclopentyl]pyrrole-2,5-dione |
| SMILES | CCCCO[C@@H]1[C@@H](OCCCC)[C@@H](OCCCC)C(N2C(=O)C=CC2=O)[C@@H]1OCCCC |
| InChI | InChI=1S/C25H43NO6/c1-5-9-15-29-22-21(26-19(27)13-14-20(26)28)23(30-16-10-6-2)25(32-18-12-8-4)24(22)31-17-11-7-3/h13-14,21-25H,5-12,15-18H2,1-4H3/t22-,23-,24-,25-/m0/s1 |
| InChIKey | AQIYJLLZQQNHFL-QORCZRPOSA-N |
| XLogP | 4.03 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.62 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|