About octadecyl 2-methylprop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate
octadecyl 2-methylprop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate (PubChem CID 18439183) has the molecular formula C29H52O5
and a molecular weight of 480.73 g/mol. Its IUPAC name is octadecyl 2-methylprop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | octadecyl 2-methylprop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate |
| PubChem CID | 18439183 |
| Molecular Formula | C29H52O5 |
| Molecular Weight | 480.73 g/mol |
| Exact Mass | 480.38 |
| IUPAC Name | octadecyl 2-methylprop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1CO1.C=C(C)C(=O)OCCCCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C22H42O2.C7H10O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-22(23)21(2)3;1-5(2)7(8)10-4-6-3-9-6/h2,4-20H2,1,3H3;6H,1,3-4H2,2H3 |
| InChIKey | OGOPQKWQGIJETC-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.73 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze octadecyl 2-methylprop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadecyl 2-methylprop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate?
The IUPAC name of octadecyl 2-methylprop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate (CID 18439183) is octadecyl 2-methylprop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate.
What is the SMILES notation for octadecyl 2-methylprop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate?
The canonical SMILES for octadecyl 2-methylprop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate is C=C(C)C(=O)OCC1CO1.C=C(C)C(=O)OCCCCCCCCCCCCCCCCCC.
What is the InChIKey of octadecyl 2-methylprop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate?
The InChIKey is OGOPQKWQGIJETC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42O2.C7H10O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-22(23)21(2)3;1-5(2)7(8)10-4-6-3-9-6/h2,4-20H2,1,3H3;6H,1,3-4H2,2H3.
What are the key properties of octadecyl 2-methylprop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate?
octadecyl 2-methylprop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate has a molecular weight of 480.73 g/mol, XLogP of 7.87, 21 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for octadecyl 2-methylprop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate is sourced from PubChem (CID 18439183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).