About 1-(6,7-difluoro-1,3-benzodioxol-5-yl)-5-methylpyridin-2-one
1-(6,7-difluoro-1,3-benzodioxol-5-yl)-5-methylpyridin-2-one (PubChem CID 18439303) has the molecular formula C13H9F2NO3
and a molecular weight of 265.21 g/mol. Its IUPAC name is 1-(6,7-difluoro-1,3-benzodioxol-5-yl)-5-methylpyridin-2-one.
Molecular Properties
| Compound Name | 1-(6,7-difluoro-1,3-benzodioxol-5-yl)-5-methylpyridin-2-one |
| PubChem CID | 18439303 |
| Molecular Formula | C13H9F2NO3 |
| Molecular Weight | 265.21 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 1-(6,7-difluoro-1,3-benzodioxol-5-yl)-5-methylpyridin-2-one |
| SMILES | Cc1ccc(=O)n(-c2cc3c(c(F)c2F)OCO3)c1 |
| InChI | InChI=1S/C13H9F2NO3/c1-7-2-3-10(17)16(5-7)8-4-9-13(19-6-18-9)12(15)11(8)14/h2-5H,6H2,1H3 |
| InChIKey | ZAUALDWPYALAPL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.21 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(6,7-difluoro-1,3-benzodioxol-5-yl)-5-methylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6,7-difluoro-1,3-benzodioxol-5-yl)-5-methylpyridin-2-one?
The IUPAC name of 1-(6,7-difluoro-1,3-benzodioxol-5-yl)-5-methylpyridin-2-one (CID 18439303) is 1-(6,7-difluoro-1,3-benzodioxol-5-yl)-5-methylpyridin-2-one.
What is the SMILES notation for 1-(6,7-difluoro-1,3-benzodioxol-5-yl)-5-methylpyridin-2-one?
The canonical SMILES for 1-(6,7-difluoro-1,3-benzodioxol-5-yl)-5-methylpyridin-2-one is Cc1ccc(=O)n(-c2cc3c(c(F)c2F)OCO3)c1.
What is the InChIKey of 1-(6,7-difluoro-1,3-benzodioxol-5-yl)-5-methylpyridin-2-one?
The InChIKey is ZAUALDWPYALAPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9F2NO3/c1-7-2-3-10(17)16(5-7)8-4-9-13(19-6-18-9)12(15)11(8)14/h2-5H,6H2,1H3.
What are the key properties of 1-(6,7-difluoro-1,3-benzodioxol-5-yl)-5-methylpyridin-2-one?
1-(6,7-difluoro-1,3-benzodioxol-5-yl)-5-methylpyridin-2-one has a molecular weight of 265.21 g/mol, XLogP of 2.15, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6,7-difluoro-1,3-benzodioxol-5-yl)-5-methylpyridin-2-one is sourced from PubChem (CID 18439303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).