About 8-fluoro-7H-pyrrolo[2,1-c][1,4]benzodiazepine
8-fluoro-7H-pyrrolo[2,1-c][1,4]benzodiazepine (PubChem CID 18439640) has the molecular formula C12H9FN2
and a molecular weight of 200.22 g/mol. Its IUPAC name is 8-fluoro-7H-pyrrolo[2,1-c][1,4]benzodiazepine.
Molecular Properties
| Compound Name | 8-fluoro-7H-pyrrolo[2,1-c][1,4]benzodiazepine |
| PubChem CID | 18439640 |
| Molecular Formula | C12H9FN2 |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 8-fluoro-7H-pyrrolo[2,1-c][1,4]benzodiazepine |
| SMILES | FC1=CN2C=c3ccccc3=NC=C2C1 |
| InChI | InChI=1S/C12H9FN2/c13-10-5-11-6-14-12-4-2-1-3-9(12)7-15(11)8-10/h1-4,6-8H,5H2 |
| InChIKey | ZNEHADQLYYCNLB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-fluoro-7H-pyrrolo[2,1-c][1,4]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-7H-pyrrolo[2,1-c][1,4]benzodiazepine?
The IUPAC name of 8-fluoro-7H-pyrrolo[2,1-c][1,4]benzodiazepine (CID 18439640) is 8-fluoro-7H-pyrrolo[2,1-c][1,4]benzodiazepine.
What is the SMILES notation for 8-fluoro-7H-pyrrolo[2,1-c][1,4]benzodiazepine?
The canonical SMILES for 8-fluoro-7H-pyrrolo[2,1-c][1,4]benzodiazepine is FC1=CN2C=c3ccccc3=NC=C2C1.
What is the InChIKey of 8-fluoro-7H-pyrrolo[2,1-c][1,4]benzodiazepine?
The InChIKey is ZNEHADQLYYCNLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9FN2/c13-10-5-11-6-14-12-4-2-1-3-9(12)7-15(11)8-10/h1-4,6-8H,5H2.
What are the key properties of 8-fluoro-7H-pyrrolo[2,1-c][1,4]benzodiazepine?
8-fluoro-7H-pyrrolo[2,1-c][1,4]benzodiazepine has a molecular weight of 200.22 g/mol, XLogP of 1.42, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-7H-pyrrolo[2,1-c][1,4]benzodiazepine is sourced from PubChem (CID 18439640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).