C22H15ClN2O2 — CID 18440189
3-[[4-(4-chlorobenzoyl)naphthalen-2-yl]methyl]-1H-pyridazin-6-one (PubChem CID 18440189) has the molecular formula C22H15ClN2O2 and a molecular weight of 374.83 g/mol. Its IUPAC name is 3-[[4-(4-chlorobenzoyl)naphthalen-2-yl]methyl]-1H-pyridazin-6-one.
| Compound Name | 3-[[4-(4-chlorobenzoyl)naphthalen-2-yl]methyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 18440189 |
| Molecular Formula | C22H15ClN2O2 |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 3-[[4-(4-chlorobenzoyl)naphthalen-2-yl]methyl]-1H-pyridazin-6-one |
| SMILES | O=C(c1ccc(Cl)cc1)c1cc(Cc2ccc(=O)[nH]n2)cc2ccccc12 |
| InChI | InChI=1S/C22H15ClN2O2/c23-17-7-5-15(6-8-17)22(27)20-13-14(11-16-3-1-2-4-19(16)20)12-18-9-10-21(26)25-24-18/h1-11,13H,12H2,(H,25,26) |
| InChIKey | LPLXVRVTKRYEAV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |