C23H33FN2O6 — CID 18440754
2-[2-[4-[1-[2-(1,3-dioxolan-2-yl)ethyl]-6-fluoroindol-3-yl]piperidin-1-yl]ethoxy]propane-1,2,3-triol (PubChem CID 18440754) has the molecular formula C23H33FN2O6 and a molecular weight of 452.52 g/mol. Its IUPAC name is 2-[2-[4-[1-[2-(1,3-dioxolan-2-yl)ethyl]-6-fluoroindol-3-yl]piperidin-1-yl]ethoxy]propane-1,2,3-triol.
| Compound Name | 2-[2-[4-[1-[2-(1,3-dioxolan-2-yl)ethyl]-6-fluoroindol-3-yl]piperidin-1-yl]ethoxy]propane-1,2,3-triol |
|---|---|
| PubChem CID | 18440754 |
| Molecular Formula | C23H33FN2O6 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 2-[2-[4-[1-[2-(1,3-dioxolan-2-yl)ethyl]-6-fluoroindol-3-yl]piperidin-1-yl]ethoxy]propane-1,2,3-triol |
| SMILES | OCC(O)(CO)OCCN1CCC(c2cn(CCC3OCCO3)c3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C23H33FN2O6/c24-18-1-2-19-20(14-26(21(19)13-18)8-5-22-30-11-12-31-22)17-3-6-25(7-4-17)9-10-32-23(29,15-27)16-28/h1-2,13-14,17,22,27-29H,3-12,15-16H2 |
| InChIKey | GUDAUDFBBLXPNK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|