About 2-[2-(2-fluoroanilino)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate
2-[2-(2-fluoroanilino)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate (PubChem CID 18440849) has the molecular formula C12H12FN3O3S
and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-[2-(2-fluoroanilino)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate.
Molecular Properties
| Compound Name | 2-[2-(2-fluoroanilino)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate |
| PubChem CID | 18440849 |
| Molecular Formula | C12H12FN3O3S |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 2-[2-(2-fluoroanilino)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate |
| SMILES | Cc1nc(Nc2ccccc2F)sc1CCO[N+](=O)[O-] |
| InChI | InChI=1S/C12H12FN3O3S/c1-8-11(6-7-19-16(17)18)20-12(14-8)15-10-5-3-2-4-9(10)13/h2-5H,6-7H2,1H3,(H,14,15) |
| InChIKey | WHZKYHNSPOIOGA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-fluoroanilino)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-fluoroanilino)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate?
The IUPAC name of 2-[2-(2-fluoroanilino)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate (CID 18440849) is 2-[2-(2-fluoroanilino)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate.
What is the SMILES notation for 2-[2-(2-fluoroanilino)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate?
The canonical SMILES for 2-[2-(2-fluoroanilino)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate is Cc1nc(Nc2ccccc2F)sc1CCO[N+](=O)[O-].
What is the InChIKey of 2-[2-(2-fluoroanilino)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate?
The InChIKey is WHZKYHNSPOIOGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FN3O3S/c1-8-11(6-7-19-16(17)18)20-12(14-8)15-10-5-3-2-4-9(10)13/h2-5H,6-7H2,1H3,(H,14,15).
What are the key properties of 2-[2-(2-fluoroanilino)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate?
2-[2-(2-fluoroanilino)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate has a molecular weight of 297.31 g/mol, XLogP of 3.09, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-fluoroanilino)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate is sourced from PubChem (CID 18440849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).