About 3-oxabicyclo[3.3.1]nona-1(9),5,7-triene
3-oxabicyclo[3.3.1]nona-1(9),5,7-triene (PubChem CID 18440970) has the molecular formula C8H8O
and a molecular weight of 120.15 g/mol. Its IUPAC name is 3-oxabicyclo[3.3.1]nona-1(9),5,7-triene.
Molecular Properties
| Compound Name | 3-oxabicyclo[3.3.1]nona-1(9),5,7-triene |
| PubChem CID | 18440970 |
| Molecular Formula | C8H8O |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.06 |
| IUPAC Name | 3-oxabicyclo[3.3.1]nona-1(9),5,7-triene |
| SMILES | c1cc2cc(c1)COC2 |
| InChI | InChI=1S/C8H8O/c1-2-7-4-8(3-1)6-9-5-7/h1-4H,5-6H2 |
| InChIKey | DONPBOYMUMBGCQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-oxabicyclo[3.3.1]nona-1(9),5,7-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxabicyclo[3.3.1]nona-1(9),5,7-triene?
The IUPAC name of 3-oxabicyclo[3.3.1]nona-1(9),5,7-triene (CID 18440970) is 3-oxabicyclo[3.3.1]nona-1(9),5,7-triene.
What is the SMILES notation for 3-oxabicyclo[3.3.1]nona-1(9),5,7-triene?
The canonical SMILES for 3-oxabicyclo[3.3.1]nona-1(9),5,7-triene is c1cc2cc(c1)COC2.
What is the InChIKey of 3-oxabicyclo[3.3.1]nona-1(9),5,7-triene?
The InChIKey is DONPBOYMUMBGCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O/c1-2-7-4-8(3-1)6-9-5-7/h1-4H,5-6H2.
What are the key properties of 3-oxabicyclo[3.3.1]nona-1(9),5,7-triene?
3-oxabicyclo[3.3.1]nona-1(9),5,7-triene has a molecular weight of 120.15 g/mol, XLogP of 1.72, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxabicyclo[3.3.1]nona-1(9),5,7-triene is sourced from PubChem (CID 18440970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).