C64H36BF20P — CID 18441208
tetrakis(2,3,4,5,6-pentafluoronaphthalen-1-yl)boranuide;tris(2,6-dimethylphenyl)phosphanium (PubChem CID 18441208) has the molecular formula C64H36BF20P and a molecular weight of 1226.74 g/mol. Its IUPAC name is tetrakis(2,3,4,5,6-pentafluoronaphthalen-1-yl)boranuide;tris(2,6-dimethylphenyl)phosphanium.
| Compound Name | tetrakis(2,3,4,5,6-pentafluoronaphthalen-1-yl)boranuide;tris(2,6-dimethylphenyl)phosphanium |
|---|---|
| PubChem CID | 18441208 |
| Molecular Formula | C64H36BF20P |
| Molecular Weight | 1226.74 g/mol |
| Exact Mass | 1226.23 |
| IUPAC Name | tetrakis(2,3,4,5,6-pentafluoronaphthalen-1-yl)boranuide;tris(2,6-dimethylphenyl)phosphanium |
| SMILES | Cc1cccc(C)c1[PH+](c1c(C)cccc1C)c1c(C)cccc1C.Fc1ccc2c([B-](c3c(F)c(F)c(F)c4c(F)c(F)ccc34)(c3c(F)c(F)c(F)c4c(F)c(F)ccc34)c3c(F)c(F)c(F)c4c(F)c(F)ccc34)c(F)c(F)c(F)c2c1F |
| InChI | InChI=1S/C40H8BF20.C24H27P/c42-13-5-1-9-17(25(13)46)29(50)37(58)33(54)21(9)41(22-10-2-6-14(43)26(47)18(10)30(51)38(59)34(22)55,23-11-3-7-15(44)27(48)19(11)31(52)39(60)35(23)56)24-12-4-8-16(45)28(49)20(12)32(53)40(61)36(24)57;1-16-10-7-11-17(2)22(16)25(23-18(3)12-8-13-19(23)4)24-20(5)14-9-15-21(24)6/h1-8H;7-15H,1-6H3/q-1;/p+1 |
| InChIKey | HCUKHOOFWFEUES-UHFFFAOYSA-O |
| XLogP | 15.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1226.74 |
| LogP ≤ 5 | 15.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|