About (Z)-3-amino-4-(2,4-difluorophenyl)but-2-enoic acid
(Z)-3-amino-4-(2,4-difluorophenyl)but-2-enoic acid (PubChem CID 18441895) has the molecular formula C10H9F2NO2
and a molecular weight of 213.18 g/mol. Its IUPAC name is (Z)-3-amino-4-(2,4-difluorophenyl)but-2-enoic acid.
Molecular Properties
| Compound Name | (Z)-3-amino-4-(2,4-difluorophenyl)but-2-enoic acid |
| PubChem CID | 18441895 |
| Molecular Formula | C10H9F2NO2 |
| Molecular Weight | 213.18 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | (Z)-3-amino-4-(2,4-difluorophenyl)but-2-enoic acid |
| SMILES | N/C(=C\C(=O)O)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C10H9F2NO2/c11-7-2-1-6(9(12)4-7)3-8(13)5-10(14)15/h1-2,4-5H,3,13H2,(H,14,15)/b8-5- |
| InChIKey | ISXWMGTYYKRVGX-YVMONPNESA-N |
| XLogP | 1.43 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.18 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-amino-4-(2,4-difluorophenyl)but-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-amino-4-(2,4-difluorophenyl)but-2-enoic acid?
The IUPAC name of (Z)-3-amino-4-(2,4-difluorophenyl)but-2-enoic acid (CID 18441895) is (Z)-3-amino-4-(2,4-difluorophenyl)but-2-enoic acid.
What is the SMILES notation for (Z)-3-amino-4-(2,4-difluorophenyl)but-2-enoic acid?
The canonical SMILES for (Z)-3-amino-4-(2,4-difluorophenyl)but-2-enoic acid is N/C(=C\C(=O)O)Cc1ccc(F)cc1F.
What is the InChIKey of (Z)-3-amino-4-(2,4-difluorophenyl)but-2-enoic acid?
The InChIKey is ISXWMGTYYKRVGX-YVMONPNESA-N. The full InChI is InChI=1S/C10H9F2NO2/c11-7-2-1-6(9(12)4-7)3-8(13)5-10(14)15/h1-2,4-5H,3,13H2,(H,14,15)/b8-5-.
What are the key properties of (Z)-3-amino-4-(2,4-difluorophenyl)but-2-enoic acid?
(Z)-3-amino-4-(2,4-difluorophenyl)but-2-enoic acid has a molecular weight of 213.18 g/mol, XLogP of 1.43, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-amino-4-(2,4-difluorophenyl)but-2-enoic acid is sourced from PubChem (CID 18441895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).