About 2,2,3,3-tetraethoxybutane
2,2,3,3-tetraethoxybutane (PubChem CID 18442121) has the molecular formula C12H26O4
and a molecular weight of 234.34 g/mol. Its IUPAC name is 2,2,3,3-tetraethoxybutane.
Molecular Properties
| Compound Name | 2,2,3,3-tetraethoxybutane |
| PubChem CID | 18442121 |
| Molecular Formula | C12H26O4 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 2,2,3,3-tetraethoxybutane |
| SMILES | CCOC(C)(OCC)C(C)(OCC)OCC |
| InChI | InChI=1S/C12H26O4/c1-7-13-11(5,14-8-2)12(6,15-9-3)16-10-4/h7-10H2,1-6H3 |
| InChIKey | QTVQPBOTRAAVSQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2,3,3-tetraethoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,3,3-tetraethoxybutane?
The IUPAC name of 2,2,3,3-tetraethoxybutane (CID 18442121) is 2,2,3,3-tetraethoxybutane.
What is the SMILES notation for 2,2,3,3-tetraethoxybutane?
The canonical SMILES for 2,2,3,3-tetraethoxybutane is CCOC(C)(OCC)C(C)(OCC)OCC.
What is the InChIKey of 2,2,3,3-tetraethoxybutane?
The InChIKey is QTVQPBOTRAAVSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O4/c1-7-13-11(5,14-8-2)12(6,15-9-3)16-10-4/h7-10H2,1-6H3.
What are the key properties of 2,2,3,3-tetraethoxybutane?
2,2,3,3-tetraethoxybutane has a molecular weight of 234.34 g/mol, XLogP of 2.56, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,3,3-tetraethoxybutane is sourced from PubChem (CID 18442121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).