C9H11NO3 — CID 18442605
2,3,4a,8a-tetrahydro-1,4-benzodioxine-3-carboxamide (PubChem CID 18442605) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is 2,3,4a,8a-tetrahydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | 2,3,4a,8a-tetrahydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 18442605 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 2,3,4a,8a-tetrahydro-1,4-benzodioxine-3-carboxamide |
| SMILES | NC(=O)C1COC2C=CC=CC2O1 |
| InChI | InChI=1S/C9H11NO3/c10-9(11)8-5-12-6-3-1-2-4-7(6)13-8/h1-4,6-8H,5H2,(H2,10,11) |
| InChIKey | LEXVVWQATLCGCY-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |