C21H27N3O4 — CID 18442627
N-[4-(2-benzoyl-3,4-dihydropyridazin-1-yl)-1-cyclopentyl-4-oxobutan-2-yl]-N-hydroxyformamide (PubChem CID 18442627) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is N-[4-(2-benzoyl-3,4-dihydropyridazin-1-yl)-1-cyclopentyl-4-oxobutan-2-yl]-N-hydroxyformamide.
| Compound Name | N-[4-(2-benzoyl-3,4-dihydropyridazin-1-yl)-1-cyclopentyl-4-oxobutan-2-yl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 18442627 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | N-[4-(2-benzoyl-3,4-dihydropyridazin-1-yl)-1-cyclopentyl-4-oxobutan-2-yl]-N-hydroxyformamide |
| SMILES | O=CN(O)C(CC(=O)N1C=CCCN1C(=O)c1ccccc1)CC1CCCC1 |
| InChI | InChI=1S/C21H27N3O4/c25-16-24(28)19(14-17-8-4-5-9-17)15-20(26)22-12-6-7-13-23(22)21(27)18-10-2-1-3-11-18/h1-3,6,10-12,16-17,19,28H,4-5,7-9,13-15H2 |
| InChIKey | MPKRYRVUVXPIGF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|