About 1H-pyrrolo[3,4-b]pyrrole-4,6-dione
1H-pyrrolo[3,4-b]pyrrole-4,6-dione (PubChem CID 18442732) has the molecular formula C6H4N2O2
and a molecular weight of 136.11 g/mol. Its IUPAC name is 1H-pyrrolo[3,4-b]pyrrole-4,6-dione.
Molecular Properties
| Compound Name | 1H-pyrrolo[3,4-b]pyrrole-4,6-dione |
| PubChem CID | 18442732 |
| Molecular Formula | C6H4N2O2 |
| Molecular Weight | 136.11 g/mol |
| Exact Mass | 136.03 |
| IUPAC Name | 1H-pyrrolo[3,4-b]pyrrole-4,6-dione |
| SMILES | O=C1NC(=O)c2[nH]ccc21 |
| InChI | InChI=1S/C6H4N2O2/c9-5-3-1-2-7-4(3)6(10)8-5/h1-2,7H,(H,8,9,10) |
| InChIKey | TVIWRNMTKUCHTA-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.11 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyrrolo[3,4-b]pyrrole-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrolo[3,4-b]pyrrole-4,6-dione?
The IUPAC name of 1H-pyrrolo[3,4-b]pyrrole-4,6-dione (CID 18442732) is 1H-pyrrolo[3,4-b]pyrrole-4,6-dione.
What is the SMILES notation for 1H-pyrrolo[3,4-b]pyrrole-4,6-dione?
The canonical SMILES for 1H-pyrrolo[3,4-b]pyrrole-4,6-dione is O=C1NC(=O)c2[nH]ccc21.
What is the InChIKey of 1H-pyrrolo[3,4-b]pyrrole-4,6-dione?
The InChIKey is TVIWRNMTKUCHTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O2/c9-5-3-1-2-7-4(3)6(10)8-5/h1-2,7H,(H,8,9,10).
What are the key properties of 1H-pyrrolo[3,4-b]pyrrole-4,6-dione?
1H-pyrrolo[3,4-b]pyrrole-4,6-dione has a molecular weight of 136.11 g/mol, XLogP of -0.10, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrolo[3,4-b]pyrrole-4,6-dione is sourced from PubChem (CID 18442732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).