About 4H-pyrrolo[2,3-d][1,3]thiazole
4H-pyrrolo[2,3-d][1,3]thiazole (PubChem CID 18442761) has the molecular formula C5H4N2S
and a molecular weight of 124.17 g/mol. Its IUPAC name is 4H-pyrrolo[2,3-d][1,3]thiazole.
Molecular Properties
| Compound Name | 4H-pyrrolo[2,3-d][1,3]thiazole |
| PubChem CID | 18442761 |
| Molecular Formula | C5H4N2S |
| Molecular Weight | 124.17 g/mol |
| Exact Mass | 124.01 |
| IUPAC Name | 4H-pyrrolo[2,3-d][1,3]thiazole |
| SMILES | c1cc2scnc2[nH]1 |
| InChI | InChI=1S/C5H4N2S/c1-2-6-5-4(1)8-3-7-5/h1-3,6H |
| InChIKey | KFKYBWHCKOWCIS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.17 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4H-pyrrolo[2,3-d][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-pyrrolo[2,3-d][1,3]thiazole?
The IUPAC name of 4H-pyrrolo[2,3-d][1,3]thiazole (CID 18442761) is 4H-pyrrolo[2,3-d][1,3]thiazole.
What is the SMILES notation for 4H-pyrrolo[2,3-d][1,3]thiazole?
The canonical SMILES for 4H-pyrrolo[2,3-d][1,3]thiazole is c1cc2scnc2[nH]1.
What is the InChIKey of 4H-pyrrolo[2,3-d][1,3]thiazole?
The InChIKey is KFKYBWHCKOWCIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2S/c1-2-6-5-4(1)8-3-7-5/h1-3,6H.
What are the key properties of 4H-pyrrolo[2,3-d][1,3]thiazole?
4H-pyrrolo[2,3-d][1,3]thiazole has a molecular weight of 124.17 g/mol, XLogP of 1.62, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-pyrrolo[2,3-d][1,3]thiazole is sourced from PubChem (CID 18442761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).