C28H36O6 — CID 18442912
dimethyl 2-[[4-[2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)oxy]ethoxy]phenyl]methyl]propanedioate (PubChem CID 18442912) has the molecular formula C28H36O6 and a molecular weight of 468.59 g/mol. Its IUPAC name is dimethyl 2-[[4-[2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)oxy]ethoxy]phenyl]methyl]propanedioate.
| Compound Name | dimethyl 2-[[4-[2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)oxy]ethoxy]phenyl]methyl]propanedioate |
|---|---|
| PubChem CID | 18442912 |
| Molecular Formula | C28H36O6 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | dimethyl 2-[[4-[2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)oxy]ethoxy]phenyl]methyl]propanedioate |
| SMILES | COC(=O)C(Cc1ccc(OCCOc2ccc3c(c2)C(C)(C)CCC3(C)C)cc1)C(=O)OC |
| InChI | InChI=1S/C28H36O6/c1-27(2)13-14-28(3,4)24-18-21(11-12-23(24)27)34-16-15-33-20-9-7-19(8-10-20)17-22(25(29)31-5)26(30)32-6/h7-12,18,22H,13-17H2,1-6H3 |
| InChIKey | VVIOFNLYMYRTDZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|