C8H21F3O4Si4 — CID 18443983
2,2,4,4,6,6,8-heptamethyl-8-(trifluoromethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 18443983) has the molecular formula C8H21F3O4Si4 and a molecular weight of 350.59 g/mol. Its IUPAC name is 2,2,4,4,6,6,8-heptamethyl-8-(trifluoromethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,2,4,4,6,6,8-heptamethyl-8-(trifluoromethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 18443983 |
| Molecular Formula | C8H21F3O4Si4 |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 2,2,4,4,6,6,8-heptamethyl-8-(trifluoromethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si](C)(C(F)(F)F)O[Si](C)(C)O1 |
| InChI | InChI=1S/C8H21F3O4Si4/c1-16(2)12-17(3,4)14-19(7,8(9,10)11)15-18(5,6)13-16/h1-7H3 |
| InChIKey | FPHSQKUDTOSKOA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|