C16H30O7 — CID 18444066
[(2R,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl] decanoate (PubChem CID 18444066) has the molecular formula C16H30O7 and a molecular weight of 334.41 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl] decanoate.
| Compound Name | [(2R,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl] decanoate |
|---|---|
| PubChem CID | 18444066 |
| Molecular Formula | C16H30O7 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)O[C@@]1(CO)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H30O7/c1-2-3-4-5-6-7-8-9-13(19)23-16(11-18)15(21)14(20)12(10-17)22-16/h12,14-15,17-18,20-21H,2-11H2,1H3/t12-,14-,15+,16-/m1/s1 |
| InChIKey | CXHXORKCCBOMCU-DMRZNYOFSA-N |
| XLogP | 0.47 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|