C24H50O — CID 18444100
2-(2,3-dimethyldecan-2-yloxy)-2,3-dimethyldecane (PubChem CID 18444100) has the molecular formula C24H50O and a molecular weight of 354.66 g/mol. Its IUPAC name is 2-(2,3-dimethyldecan-2-yloxy)-2,3-dimethyldecane.
| Compound Name | 2-(2,3-dimethyldecan-2-yloxy)-2,3-dimethyldecane |
|---|---|
| PubChem CID | 18444100 |
| Molecular Formula | C24H50O |
| Molecular Weight | 354.66 g/mol |
| Exact Mass | 354.39 |
| IUPAC Name | 2-(2,3-dimethyldecan-2-yloxy)-2,3-dimethyldecane |
| SMILES | CCCCCCCC(C)C(C)(C)OC(C)(C)C(C)CCCCCCC |
| InChI | InChI=1S/C24H50O/c1-9-11-13-15-17-19-21(3)23(5,6)25-24(7,8)22(4)20-18-16-14-12-10-2/h21-22H,9-20H2,1-8H3 |
| InChIKey | AFDBZPRTAKWRON-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.66 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|