C10H14N2 — CID 18444221
2,3,4,5-tetrahydro-1H-1-benzazepin-8-amine (PubChem CID 18444221) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 2,3,4,5-tetrahydro-1H-1-benzazepin-8-amine.
| Compound Name | 2,3,4,5-tetrahydro-1H-1-benzazepin-8-amine |
|---|---|
| PubChem CID | 18444221 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2,3,4,5-tetrahydro-1H-1-benzazepin-8-amine |
| SMILES | Nc1ccc2c(c1)NCCCC2 |
| InChI | InChI=1S/C10H14N2/c11-9-5-4-8-3-1-2-6-12-10(8)7-9/h4-5,7,12H,1-3,6,11H2 |
| InChIKey | KNIPUMXQKNWUSP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|