C19H23FN4O2 — CID 18444483
4-[2-(aminomethyl)-3-[(2-fluorophenyl)methylamino]phenyl]piperazine-1-carboxylic acid (PubChem CID 18444483) has the molecular formula C19H23FN4O2 and a molecular weight of 358.42 g/mol. Its IUPAC name is 4-[2-(aminomethyl)-3-[(2-fluorophenyl)methylamino]phenyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[2-(aminomethyl)-3-[(2-fluorophenyl)methylamino]phenyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 18444483 |
| Molecular Formula | C19H23FN4O2 |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 4-[2-(aminomethyl)-3-[(2-fluorophenyl)methylamino]phenyl]piperazine-1-carboxylic acid |
| SMILES | NCc1c(NCc2ccccc2F)cccc1N1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C19H23FN4O2/c20-16-5-2-1-4-14(16)13-22-17-6-3-7-18(15(17)12-21)23-8-10-24(11-9-23)19(25)26/h1-7,22H,8-13,21H2,(H,25,26) |
| InChIKey | CFQMMQSDTUHLML-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |