C21H19F2NO4 — CID 18444565
4-[[4-[4-(difluoromethoxy)phenyl]-N-methylanilino]methyl]-5-methylfuran-2-carboxylic acid (PubChem CID 18444565) has the molecular formula C21H19F2NO4 and a molecular weight of 387.38 g/mol. Its IUPAC name is 4-[[4-[4-(difluoromethoxy)phenyl]-N-methylanilino]methyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[[4-[4-(difluoromethoxy)phenyl]-N-methylanilino]methyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 18444565 |
| Molecular Formula | C21H19F2NO4 |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 4-[[4-[4-(difluoromethoxy)phenyl]-N-methylanilino]methyl]-5-methylfuran-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1CN(C)c1ccc(-c2ccc(OC(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H19F2NO4/c1-13-16(11-19(27-13)20(25)26)12-24(2)17-7-3-14(4-8-17)15-5-9-18(10-6-15)28-21(22)23/h3-11,21H,12H2,1-2H3,(H,25,26) |
| InChIKey | AKDYETVPYDYEJE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |