5-ethoxy-2,5-difluorocyclohexa-1,3-diene-1-carboxylic acid

C9H10F2O3 — CID 18444796

IUPAC5-ethoxy-2,5-difluorocyclohexa-1,3-diene-1-carboxylic acid
SMILESCCOC1(F)C=CC(F)=C(C(=O)O)C1
InChIInChI=1S/C9H10F2O3/c1-2-14-9(11)4-3-7(10)6(5-9)8(12)13/h3-4H,2,5H2,1H3,(H,12,13)
InChIKeyZIFDJMAMEVAMJK-UHFFFAOYSA-N
MW204.17 g/mol
LogP1.96
Rot. Bonds3

About 5-ethoxy-2,5-difluorocyclohexa-1,3-diene-1-carboxylic acid

5-ethoxy-2,5-difluorocyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 18444796) has the molecular formula C9H10F2O3 and a molecular weight of 204.17 g/mol. Its IUPAC name is 5-ethoxy-2,5-difluorocyclohexa-1,3-diene-1-carboxylic acid.

Molecular Properties

Compound Name5-ethoxy-2,5-difluorocyclohexa-1,3-diene-1-carboxylic acid
PubChem CID18444796
Molecular FormulaC9H10F2O3
Molecular Weight204.17 g/mol
Exact Mass204.06
IUPAC Name5-ethoxy-2,5-difluorocyclohexa-1,3-diene-1-carboxylic acid
SMILESCCOC1(F)C=CC(F)=C(C(=O)O)C1
InChIInChI=1S/C9H10F2O3/c1-2-14-9(11)4-3-7(10)6(5-9)8(12)13/h3-4H,2,5H2,1H3,(H,12,13)
InChIKeyZIFDJMAMEVAMJK-UHFFFAOYSA-N
XLogP1.96
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.17
LogP ≤ 51.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 5-ethoxy-2,5-difluorocyclohexa-1,3-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-ethoxy-2,5-difluorocyclohexa-1,3-diene-1-carboxylic acid?
The IUPAC name of 5-ethoxy-2,5-difluorocyclohexa-1,3-diene-1-carboxylic acid (CID 18444796) is 5-ethoxy-2,5-difluorocyclohexa-1,3-diene-1-carboxylic acid.
What is the SMILES notation for 5-ethoxy-2,5-difluorocyclohexa-1,3-diene-1-carboxylic acid?
The canonical SMILES for 5-ethoxy-2,5-difluorocyclohexa-1,3-diene-1-carboxylic acid is CCOC1(F)C=CC(F)=C(C(=O)O)C1.
What is the InChIKey of 5-ethoxy-2,5-difluorocyclohexa-1,3-diene-1-carboxylic acid?
The InChIKey is ZIFDJMAMEVAMJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F2O3/c1-2-14-9(11)4-3-7(10)6(5-9)8(12)13/h3-4H,2,5H2,1H3,(H,12,13).
What are the key properties of 5-ethoxy-2,5-difluorocyclohexa-1,3-diene-1-carboxylic acid?
5-ethoxy-2,5-difluorocyclohexa-1,3-diene-1-carboxylic acid has a molecular weight of 204.17 g/mol, XLogP of 1.96, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-2,5-difluorocyclohexa-1,3-diene-1-carboxylic acid is sourced from PubChem (CID 18444796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).