C25H34F2N6O2 — CID 18444866
1-cyclopentyl-7-[4-(diethylamino)butylamino]-3-(2,6-difluoro-3-hydroxyphenyl)-4H-pyrimido[4,5-d]pyrimidin-2-one (PubChem CID 18444866) has the molecular formula C25H34F2N6O2 and a molecular weight of 488.58 g/mol. Its IUPAC name is 1-cyclopentyl-7-[4-(diethylamino)butylamino]-3-(2,6-difluoro-3-hydroxyphenyl)-4H-pyrimido[4,5-d]pyrimidin-2-one.
| Compound Name | 1-cyclopentyl-7-[4-(diethylamino)butylamino]-3-(2,6-difluoro-3-hydroxyphenyl)-4H-pyrimido[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 18444866 |
| Molecular Formula | C25H34F2N6O2 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | 1-cyclopentyl-7-[4-(diethylamino)butylamino]-3-(2,6-difluoro-3-hydroxyphenyl)-4H-pyrimido[4,5-d]pyrimidin-2-one |
| SMILES | CCN(CC)CCCCNc1ncc2c(n1)N(C1CCCC1)C(=O)N(c1c(F)ccc(O)c1F)C2 |
| InChI | InChI=1S/C25H34F2N6O2/c1-3-31(4-2)14-8-7-13-28-24-29-15-17-16-32(22-19(26)11-12-20(34)21(22)27)25(35)33(23(17)30-24)18-9-5-6-10-18/h11-12,15,18,34H,3-10,13-14,16H2,1-2H3,(H,28,29,30) |
| InChIKey | PYVQHFYNCDDUIZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|