About 6-hydroxy-7-methoxy-3,1-benzoxazin-4-one
6-hydroxy-7-methoxy-3,1-benzoxazin-4-one (PubChem CID 18445191) has the molecular formula C9H7NO4
and a molecular weight of 193.16 g/mol. Its IUPAC name is 6-hydroxy-7-methoxy-3,1-benzoxazin-4-one.
Molecular Properties
| Compound Name | 6-hydroxy-7-methoxy-3,1-benzoxazin-4-one |
| PubChem CID | 18445191 |
| Molecular Formula | C9H7NO4 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 6-hydroxy-7-methoxy-3,1-benzoxazin-4-one |
| SMILES | COc1cc2ncoc(=O)c2cc1O |
| InChI | InChI=1S/C9H7NO4/c1-13-8-3-6-5(2-7(8)11)9(12)14-4-10-6/h2-4,11H,1H3 |
| InChIKey | SFLGLWOYUBGHDV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-hydroxy-7-methoxy-3,1-benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-7-methoxy-3,1-benzoxazin-4-one?
The IUPAC name of 6-hydroxy-7-methoxy-3,1-benzoxazin-4-one (CID 18445191) is 6-hydroxy-7-methoxy-3,1-benzoxazin-4-one.
What is the SMILES notation for 6-hydroxy-7-methoxy-3,1-benzoxazin-4-one?
The canonical SMILES for 6-hydroxy-7-methoxy-3,1-benzoxazin-4-one is COc1cc2ncoc(=O)c2cc1O.
What is the InChIKey of 6-hydroxy-7-methoxy-3,1-benzoxazin-4-one?
The InChIKey is SFLGLWOYUBGHDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO4/c1-13-8-3-6-5(2-7(8)11)9(12)14-4-10-6/h2-4,11H,1H3.
What are the key properties of 6-hydroxy-7-methoxy-3,1-benzoxazin-4-one?
6-hydroxy-7-methoxy-3,1-benzoxazin-4-one has a molecular weight of 193.16 g/mol, XLogP of 0.90, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-7-methoxy-3,1-benzoxazin-4-one is sourced from PubChem (CID 18445191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).