About 3-[3,3-dimethyl-5-(1,3-oxazol-2-yl)-2H-1-benzofuran-7-yl]-4-(trifluoromethoxy)benzaldehyde
3-[3,3-dimethyl-5-(1,3-oxazol-2-yl)-2H-1-benzofuran-7-yl]-4-(trifluoromethoxy)benzaldehyde (PubChem CID 18445398) has the molecular formula C21H16F3NO4
and a molecular weight of 403.36 g/mol. Its IUPAC name is 3-[3,3-dimethyl-5-(1,3-oxazol-2-yl)-2H-1-benzofuran-7-yl]-4-(trifluoromethoxy)benzaldehyde.
Molecular Properties
| Compound Name | 3-[3,3-dimethyl-5-(1,3-oxazol-2-yl)-2H-1-benzofuran-7-yl]-4-(trifluoromethoxy)benzaldehyde |
| PubChem CID | 18445398 |
| Molecular Formula | C21H16F3NO4 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 3-[3,3-dimethyl-5-(1,3-oxazol-2-yl)-2H-1-benzofuran-7-yl]-4-(trifluoromethoxy)benzaldehyde |
| SMILES | CC1(C)COc2c(-c3cc(C=O)ccc3OC(F)(F)F)cc(-c3ncco3)cc21 |
| InChI | InChI=1S/C21H16F3NO4/c1-20(2)11-28-18-15(8-13(9-16(18)20)19-25-5-6-27-19)14-7-12(10-26)3-4-17(14)29-21(22,23)24/h3-10H,11H2,1-2H3 |
| InChIKey | WYECIUFNZIFPFR-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-[3,3-dimethyl-5-(1,3-oxazol-2-yl)-2H-1-benzofuran-7-yl]-4-(trifluoromethoxy)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,3-dimethyl-5-(1,3-oxazol-2-yl)-2H-1-benzofuran-7-yl]-4-(trifluoromethoxy)benzaldehyde?
The IUPAC name of 3-[3,3-dimethyl-5-(1,3-oxazol-2-yl)-2H-1-benzofuran-7-yl]-4-(trifluoromethoxy)benzaldehyde (CID 18445398) is 3-[3,3-dimethyl-5-(1,3-oxazol-2-yl)-2H-1-benzofuran-7-yl]-4-(trifluoromethoxy)benzaldehyde.
What is the SMILES notation for 3-[3,3-dimethyl-5-(1,3-oxazol-2-yl)-2H-1-benzofuran-7-yl]-4-(trifluoromethoxy)benzaldehyde?
The canonical SMILES for 3-[3,3-dimethyl-5-(1,3-oxazol-2-yl)-2H-1-benzofuran-7-yl]-4-(trifluoromethoxy)benzaldehyde is CC1(C)COc2c(-c3cc(C=O)ccc3OC(F)(F)F)cc(-c3ncco3)cc21.
What is the InChIKey of 3-[3,3-dimethyl-5-(1,3-oxazol-2-yl)-2H-1-benzofuran-7-yl]-4-(trifluoromethoxy)benzaldehyde?
The InChIKey is WYECIUFNZIFPFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16F3NO4/c1-20(2)11-28-18-15(8-13(9-16(18)20)19-25-5-6-27-19)14-7-12(10-26)3-4-17(14)29-21(22,23)24/h3-10H,11H2,1-2H3.
What are the key properties of 3-[3,3-dimethyl-5-(1,3-oxazol-2-yl)-2H-1-benzofuran-7-yl]-4-(trifluoromethoxy)benzaldehyde?
3-[3,3-dimethyl-5-(1,3-oxazol-2-yl)-2H-1-benzofuran-7-yl]-4-(trifluoromethoxy)benzaldehyde has a molecular weight of 403.36 g/mol, XLogP of 5.39, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,3-dimethyl-5-(1,3-oxazol-2-yl)-2H-1-benzofuran-7-yl]-4-(trifluoromethoxy)benzaldehyde is sourced from PubChem (CID 18445398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).