About N-phenyl-4,5-dihydro-1H-thieno[2,3-g]indazol-3-amine
N-phenyl-4,5-dihydro-1H-thieno[2,3-g]indazol-3-amine (PubChem CID 18445647) has the molecular formula C15H13N3S
and a molecular weight of 267.36 g/mol. Its IUPAC name is N-phenyl-4,5-dihydro-1H-thieno[2,3-g]indazol-3-amine.
Molecular Properties
| Compound Name | N-phenyl-4,5-dihydro-1H-thieno[2,3-g]indazol-3-amine |
| PubChem CID | 18445647 |
| Molecular Formula | C15H13N3S |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | N-phenyl-4,5-dihydro-1H-thieno[2,3-g]indazol-3-amine |
| SMILES | c1ccc(Nc2n[nH]c3c2CCc2sccc2-3)cc1 |
| InChI | InChI=1S/C15H13N3S/c1-2-4-10(5-3-1)16-15-12-6-7-13-11(8-9-19-13)14(12)17-18-15/h1-5,8-9H,6-7H2,(H2,16,17,18) |
| InChIKey | TYTVTPLSJNCNMU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-phenyl-4,5-dihydro-1H-thieno[2,3-g]indazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-4,5-dihydro-1H-thieno[2,3-g]indazol-3-amine?
The IUPAC name of N-phenyl-4,5-dihydro-1H-thieno[2,3-g]indazol-3-amine (CID 18445647) is N-phenyl-4,5-dihydro-1H-thieno[2,3-g]indazol-3-amine.
What is the SMILES notation for N-phenyl-4,5-dihydro-1H-thieno[2,3-g]indazol-3-amine?
The canonical SMILES for N-phenyl-4,5-dihydro-1H-thieno[2,3-g]indazol-3-amine is c1ccc(Nc2n[nH]c3c2CCc2sccc2-3)cc1.
What is the InChIKey of N-phenyl-4,5-dihydro-1H-thieno[2,3-g]indazol-3-amine?
The InChIKey is TYTVTPLSJNCNMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3S/c1-2-4-10(5-3-1)16-15-12-6-7-13-11(8-9-19-13)14(12)17-18-15/h1-5,8-9H,6-7H2,(H2,16,17,18).
What are the key properties of N-phenyl-4,5-dihydro-1H-thieno[2,3-g]indazol-3-amine?
N-phenyl-4,5-dihydro-1H-thieno[2,3-g]indazol-3-amine has a molecular weight of 267.36 g/mol, XLogP of 3.98, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-4,5-dihydro-1H-thieno[2,3-g]indazol-3-amine is sourced from PubChem (CID 18445647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).