C21H23FN4O — CID 18445678
5-[3-(dimethylamino)propoxy]-N-(4-fluorophenyl)-1,4-dihydroindeno[2,1-d]pyrazol-3-amine (PubChem CID 18445678) has the molecular formula C21H23FN4O and a molecular weight of 366.44 g/mol. Its IUPAC name is 5-[3-(dimethylamino)propoxy]-N-(4-fluorophenyl)-1,4-dihydroindeno[2,1-d]pyrazol-3-amine.
| Compound Name | 5-[3-(dimethylamino)propoxy]-N-(4-fluorophenyl)-1,4-dihydroindeno[2,1-d]pyrazol-3-amine |
|---|---|
| PubChem CID | 18445678 |
| Molecular Formula | C21H23FN4O |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 5-[3-(dimethylamino)propoxy]-N-(4-fluorophenyl)-1,4-dihydroindeno[2,1-d]pyrazol-3-amine |
| SMILES | CN(C)CCCOc1cccc2c1Cc1c(Nc3ccc(F)cc3)n[nH]c1-2 |
| InChI | InChI=1S/C21H23FN4O/c1-26(2)11-4-12-27-19-6-3-5-16-17(19)13-18-20(16)24-25-21(18)23-15-9-7-14(22)8-10-15/h3,5-10H,4,11-13H2,1-2H3,(H2,23,24,25) |
| InChIKey | VNMDXKSCLCAFCC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|