About 6-fluoro-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine
6-fluoro-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine (PubChem CID 18445815) has the molecular formula C16H12FN3
and a molecular weight of 265.29 g/mol. Its IUPAC name is 6-fluoro-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine.
Molecular Properties
| Compound Name | 6-fluoro-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine |
| PubChem CID | 18445815 |
| Molecular Formula | C16H12FN3 |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 6-fluoro-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine |
| SMILES | Fc1ccc2c(c1)Cc1c(Nc3ccccc3)n[nH]c1-2 |
| InChI | InChI=1S/C16H12FN3/c17-11-6-7-13-10(8-11)9-14-15(13)19-20-16(14)18-12-4-2-1-3-5-12/h1-8H,9H2,(H2,18,19,20) |
| InChIKey | DIQUEMFRDBWWOS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluoro-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine?
The IUPAC name of 6-fluoro-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine (CID 18445815) is 6-fluoro-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine.
What is the SMILES notation for 6-fluoro-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine?
The canonical SMILES for 6-fluoro-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine is Fc1ccc2c(c1)Cc1c(Nc3ccccc3)n[nH]c1-2.
What is the InChIKey of 6-fluoro-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine?
The InChIKey is DIQUEMFRDBWWOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12FN3/c17-11-6-7-13-10(8-11)9-14-15(13)19-20-16(14)18-12-4-2-1-3-5-12/h1-8H,9H2,(H2,18,19,20).
What are the key properties of 6-fluoro-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine?
6-fluoro-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine has a molecular weight of 265.29 g/mol, XLogP of 3.86, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine is sourced from PubChem (CID 18445815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).