About indeno[2,1-b]indole
indeno[2,1-b]indole (PubChem CID 18445982) has the molecular formula C15H9N
and a molecular weight of 203.24 g/mol. Its IUPAC name is indeno[2,1-b]indole.
Molecular Properties
| Compound Name | indeno[2,1-b]indole |
| PubChem CID | 18445982 |
| Molecular Formula | C15H9N |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | indeno[2,1-b]indole |
| SMILES | C1=c2ccccc2=C2C1=Nc1ccccc12 |
| InChI | InChI=1S/C15H9N/c1-2-6-11-10(5-1)9-14-15(11)12-7-3-4-8-13(12)16-14/h1-9H |
| InChIKey | BSPJVRORVHKCQW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze indeno[2,1-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indeno[2,1-b]indole?
The IUPAC name of indeno[2,1-b]indole (CID 18445982) is indeno[2,1-b]indole.
What is the SMILES notation for indeno[2,1-b]indole?
The canonical SMILES for indeno[2,1-b]indole is C1=c2ccccc2=C2C1=Nc1ccccc12.
What is the InChIKey of indeno[2,1-b]indole?
The InChIKey is BSPJVRORVHKCQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9N/c1-2-6-11-10(5-1)9-14-15(11)12-7-3-4-8-13(12)16-14/h1-9H.
What are the key properties of indeno[2,1-b]indole?
indeno[2,1-b]indole has a molecular weight of 203.24 g/mol, XLogP of 1.77, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for indeno[2,1-b]indole is sourced from PubChem (CID 18445982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).