About palladium(2+);phenyl(3-phenylphosphanylpropyl)phosphane;dibromide
palladium(2+);phenyl(3-phenylphosphanylpropyl)phosphane;dibromide (PubChem CID 18446087) has the molecular formula C15H18Br2P2Pd
and a molecular weight of 526.49 g/mol. Its IUPAC name is palladium(2+);phenyl(3-phenylphosphanylpropyl)phosphane;dibromide.
Molecular Properties
| Compound Name | palladium(2+);phenyl(3-phenylphosphanylpropyl)phosphane;dibromide |
| PubChem CID | 18446087 |
| Molecular Formula | C15H18Br2P2Pd |
| Molecular Weight | 526.49 g/mol |
| Exact Mass | 523.83 |
| IUPAC Name | palladium(2+);phenyl(3-phenylphosphanylpropyl)phosphane;dibromide |
| SMILES | [Br-].[Br-].[Pd+2].c1ccc(PCCCPc2ccccc2)cc1 |
| InChI | InChI=1S/C15H18P2.2BrH.Pd/c1-3-8-14(9-4-1)16-12-7-13-17-15-10-5-2-6-11-15;;;/h1-6,8-11,16-17H,7,12-13H2;2*1H;/q;;;+2/p-2 |
| InChIKey | XOJRSYUOMOHZLU-UHFFFAOYSA-L |
| XLogP | -2.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 526.49 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze palladium(2+);phenyl(3-phenylphosphanylpropyl)phosphane;dibromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium(2+);phenyl(3-phenylphosphanylpropyl)phosphane;dibromide?
The IUPAC name of palladium(2+);phenyl(3-phenylphosphanylpropyl)phosphane;dibromide (CID 18446087) is palladium(2+);phenyl(3-phenylphosphanylpropyl)phosphane;dibromide.
What is the SMILES notation for palladium(2+);phenyl(3-phenylphosphanylpropyl)phosphane;dibromide?
The canonical SMILES for palladium(2+);phenyl(3-phenylphosphanylpropyl)phosphane;dibromide is [Br-].[Br-].[Pd+2].c1ccc(PCCCPc2ccccc2)cc1.
What is the InChIKey of palladium(2+);phenyl(3-phenylphosphanylpropyl)phosphane;dibromide?
The InChIKey is XOJRSYUOMOHZLU-UHFFFAOYSA-L. The full InChI is InChI=1S/C15H18P2.2BrH.Pd/c1-3-8-14(9-4-1)16-12-7-13-17-15-10-5-2-6-11-15;;;/h1-6,8-11,16-17H,7,12-13H2;2*1H;/q;;;+2/p-2.
What are the key properties of palladium(2+);phenyl(3-phenylphosphanylpropyl)phosphane;dibromide?
palladium(2+);phenyl(3-phenylphosphanylpropyl)phosphane;dibromide has a molecular weight of 526.49 g/mol, XLogP of -2.61, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for palladium(2+);phenyl(3-phenylphosphanylpropyl)phosphane;dibromide is sourced from PubChem (CID 18446087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).