C31H52N12O6 — CID 18446205
2-[3-[3-(4-aminobutyl)-6-butan-2-yl-15-(1H-imidazol-5-ylmethyl)-2,5,8,11,14,17-hexaoxo-1,4,7,10,13,16-hexazabicyclo[16.3.0]henicosan-9-yl]propyl]guanidine (PubChem CID 18446205) has the molecular formula C31H52N12O6 and a molecular weight of 688.84 g/mol. Its IUPAC name is 2-[3-[3-(4-aminobutyl)-6-butan-2-yl-15-(1H-imidazol-5-ylmethyl)-2,5,8,11,14,17-hexaoxo-1,4,7,10,13,16-hexazabicyclo[16.3.0]henicosan-9-yl]propyl]guanidine.
| Compound Name | 2-[3-[3-(4-aminobutyl)-6-butan-2-yl-15-(1H-imidazol-5-ylmethyl)-2,5,8,11,14,17-hexaoxo-1,4,7,10,13,16-hexazabicyclo[16.3.0]henicosan-9-yl]propyl]guanidine |
|---|---|
| PubChem CID | 18446205 |
| Molecular Formula | C31H52N12O6 |
| Molecular Weight | 688.84 g/mol |
| Exact Mass | 688.41 |
| IUPAC Name | 2-[3-[3-(4-aminobutyl)-6-butan-2-yl-15-(1H-imidazol-5-ylmethyl)-2,5,8,11,14,17-hexaoxo-1,4,7,10,13,16-hexazabicyclo[16.3.0]henicosan-9-yl]propyl]guanidine |
| SMILES | CCC(C)C1NC(=O)C(CCCN=C(N)N)NC(=O)CNC(=O)C(Cc2cnc[nH]2)NC(=O)C2CCCN2C(=O)C(CCCCN)NC1=O |
| InChI | InChI=1S/C31H52N12O6/c1-3-18(2)25-29(48)40-21(8-4-5-11-32)30(49)43-13-7-10-23(43)28(47)41-22(14-19-15-35-17-38-19)26(45)37-16-24(44)39-20(27(46)42-25)9-6-12-36-31(33)34/h15,17-18,20-23,25H,3-14,16,32H2,1-2H3,(H,35,38)(H,37,45)(H,39,44)(H,40,48)(H,41,47)(H,42,46)(H4,33,34,36) |
| InChIKey | JNQNFASLYUIAOK-UHFFFAOYSA-N |
| XLogP | -2.76 |
| TPSA | 284.91 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.84 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|