C22H32O3 — CID 18446510
(8R,9S,13S,14S)-3-(1,3-dioxan-2-yl)-13-methyl-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 18446510) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (8R,9S,13S,14S)-3-(1,3-dioxan-2-yl)-13-methyl-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-3-(1,3-dioxan-2-yl)-13-methyl-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 18446510 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (8R,9S,13S,14S)-3-(1,3-dioxan-2-yl)-13-methyl-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H]3C4=C(CC[C@H]3[C@@H]1CCC2=O)CC(C1OCCCO1)CC4 |
| InChI | InChI=1S/C22H32O3/c1-22-10-9-17-16-5-4-15(21-24-11-2-12-25-21)13-14(16)3-6-18(17)19(22)7-8-20(22)23/h15,17-19,21H,2-13H2,1H3/t15?,17-,18-,19+,22+/m1/s1 |
| InChIKey | DQDSZEDLPJARSR-JFHCFXGKSA-N |
| XLogP | 4.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|