C8H12O4S — CID 18446734
2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole-4-carboxylic acid (PubChem CID 18446734) has the molecular formula C8H12O4S and a molecular weight of 204.25 g/mol. Its IUPAC name is 2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole-4-carboxylic acid.
| Compound Name | 2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole-4-carboxylic acid |
|---|---|
| PubChem CID | 18446734 |
| Molecular Formula | C8H12O4S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole-4-carboxylic acid |
| SMILES | CC1(C)OC2CSC(C(=O)O)C2O1 |
| InChI | InChI=1S/C8H12O4S/c1-8(2)11-4-3-13-6(7(9)10)5(4)12-8/h4-6H,3H2,1-2H3,(H,9,10) |
| InChIKey | RHHDRZIJVHABTO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |