C12H21NO5 — CID 18446788
methyl (2R,3R,7R)-3-hydroxy-7-(methoxymethoxy)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 18446788) has the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. Its IUPAC name is methyl (2R,3R,7R)-3-hydroxy-7-(methoxymethoxy)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl (2R,3R,7R)-3-hydroxy-7-(methoxymethoxy)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 18446788 |
| Molecular Formula | C12H21NO5 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | methyl (2R,3R,7R)-3-hydroxy-7-(methoxymethoxy)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COCO[C@@H]1CC2C[C@@H](O)[C@H](C(=O)OC)C1N2C |
| InChI | InChI=1S/C12H21NO5/c1-13-7-4-8(14)10(12(15)17-3)11(13)9(5-7)18-6-16-2/h7-11,14H,4-6H2,1-3H3/t7?,8-,9-,10+,11?/m1/s1 |
| InChIKey | GFTNPSWPVFUQCZ-JNUOMVRZSA-N |
| XLogP | -0.40 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|